C23H28NO3+ — CID 8992565
[(1S)-1-(4-ethylphenyl)-2-methylpropyl]-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]azanium (PubChem CID 8992565) has the molecular formula C23H28NO3+ and a molecular weight of 366.48 g/mol. Its IUPAC name is [(1S)-1-(4-ethylphenyl)-2-methylpropyl]-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]azanium.
| Compound Name | [(1S)-1-(4-ethylphenyl)-2-methylpropyl]-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 8992565 |
| Molecular Formula | C23H28NO3+ |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | [(1S)-1-(4-ethylphenyl)-2-methylpropyl]-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]azanium |
| SMILES | CCc1ccc([C@@H]([NH2+]Cc2cc(=O)oc3c(C)c(O)ccc23)C(C)C)cc1 |
| InChI | InChI=1S/C23H27NO3/c1-5-16-6-8-17(9-7-16)22(14(2)3)24-13-18-12-21(26)27-23-15(4)20(25)11-10-19(18)23/h6-12,14,22,24-25H,5,13H2,1-4H3/p+1/t22-/m0/s1 |
| InChIKey | KOWAPCUKTBDURA-QFIPXVFZSA-O |
| XLogP | 3.83 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|