C17H12F2O3S — CID 8870748
4-[(2,5-difluorophenyl)sulfanylmethyl]-7-hydroxy-8-methylchromen-2-one (PubChem CID 8870748) has the molecular formula C17H12F2O3S and a molecular weight of 334.34 g/mol. Its IUPAC name is 4-[(2,5-difluorophenyl)sulfanylmethyl]-7-hydroxy-8-methylchromen-2-one.
| Compound Name | 4-[(2,5-difluorophenyl)sulfanylmethyl]-7-hydroxy-8-methylchromen-2-one |
|---|---|
| PubChem CID | 8870748 |
| Molecular Formula | C17H12F2O3S |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 4-[(2,5-difluorophenyl)sulfanylmethyl]-7-hydroxy-8-methylchromen-2-one |
| SMILES | Cc1c(O)ccc2c(CSc3cc(F)ccc3F)cc(=O)oc12 |
| InChI | InChI=1S/C17H12F2O3S/c1-9-14(20)5-3-12-10(6-16(21)22-17(9)12)8-23-15-7-11(18)2-4-13(15)19/h2-7,20H,8H2,1H3 |
| InChIKey | APADQJGPBJKZRR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|