C16H19NO3S2 — CID 8818136
(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl N,N-diethylcarbamodithioate (PubChem CID 8818136) has the molecular formula C16H19NO3S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl N,N-diethylcarbamodithioate.
| Compound Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8818136 |
| Molecular Formula | C16H19NO3S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | (7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCc1cc(=O)oc2c(C)c(O)ccc12 |
| InChI | InChI=1S/C16H19NO3S2/c1-4-17(5-2)16(21)22-9-11-8-14(19)20-15-10(3)13(18)7-6-12(11)15/h6-8,18H,4-5,9H2,1-3H3 |
| InChIKey | QPOWPAVYBBCRFZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|