C19H27N3O5S — CID 55498462
N,N-diethyl-4-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]piperazine-1-sulfonamide (PubChem CID 55498462) has the molecular formula C19H27N3O5S and a molecular weight of 409.51 g/mol. Its IUPAC name is N,N-diethyl-4-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]piperazine-1-sulfonamide.
| Compound Name | N,N-diethyl-4-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 55498462 |
| Molecular Formula | C19H27N3O5S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | N,N-diethyl-4-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]piperazine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(Cc2cc(=O)oc3c(C)c(O)ccc23)CC1 |
| InChI | InChI=1S/C19H27N3O5S/c1-4-21(5-2)28(25,26)22-10-8-20(9-11-22)13-15-12-18(24)27-19-14(3)17(23)7-6-16(15)19/h6-7,12,23H,4-5,8-11,13H2,1-3H3 |
| InChIKey | DYUYVZDDVSJVJI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|