C22H31N3O5S — CID 55601008
4-[[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one (PubChem CID 55601008) has the molecular formula C22H31N3O5S and a molecular weight of 449.57 g/mol. Its IUPAC name is 4-[[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 55601008 |
| Molecular Formula | C22H31N3O5S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 4-[[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]methyl]-7,8-dimethylchromen-2-one |
| SMILES | Cc1ccc2c(CN3CCN(S(=O)(=O)N4CC(C)OC(C)C4)CC3)cc(=O)oc2c1C |
| InChI | InChI=1S/C22H31N3O5S/c1-15-5-6-20-19(11-21(26)30-22(20)18(15)4)14-23-7-9-24(10-8-23)31(27,28)25-12-16(2)29-17(3)13-25/h5-6,11,16-17H,7-10,12-14H2,1-4H3 |
| InChIKey | MXGMEOQXJYILOH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|