C18H23NO3S — CID 119035625
7,8-dimethyl-4-[(6-methyl-1-oxo-1,4-thiazepan-4-yl)methyl]chromen-2-one (PubChem CID 119035625) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is 7,8-dimethyl-4-[(6-methyl-1-oxo-1,4-thiazepan-4-yl)methyl]chromen-2-one.
| Compound Name | 7,8-dimethyl-4-[(6-methyl-1-oxo-1,4-thiazepan-4-yl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 119035625 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 7,8-dimethyl-4-[(6-methyl-1-oxo-1,4-thiazepan-4-yl)methyl]chromen-2-one |
| SMILES | Cc1ccc2c(CN3CCS(=O)CC(C)C3)cc(=O)oc2c1C |
| InChI | InChI=1S/C18H23NO3S/c1-12-9-19(6-7-23(21)11-12)10-15-8-17(20)22-18-14(3)13(2)4-5-16(15)18/h4-5,8,12H,6-7,9-11H2,1-3H3 |
| InChIKey | GJIJWJZLVAPZPM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|