C18H23NO2 — CID 3924084
7,8-dimethyl-4-[(2-methylpiperidin-1-yl)methyl]chromen-2-one (PubChem CID 3924084) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 7,8-dimethyl-4-[(2-methylpiperidin-1-yl)methyl]chromen-2-one.
| Compound Name | 7,8-dimethyl-4-[(2-methylpiperidin-1-yl)methyl]chromen-2-one |
|---|---|
| PubChem CID | 3924084 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 7,8-dimethyl-4-[(2-methylpiperidin-1-yl)methyl]chromen-2-one |
| SMILES | Cc1ccc2c(CN3CCCCC3C)cc(=O)oc2c1C |
| InChI | InChI=1S/C18H23NO2/c1-12-7-8-16-15(10-17(20)21-18(16)14(12)3)11-19-9-5-4-6-13(19)2/h7-8,10,13H,4-6,9,11H2,1-3H3 |
| InChIKey | MEUUBMIEFPFTSQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|