C21H28NO2+ — CID 11940283
4-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]methyl]-7,8-dimethylchromen-2-one (PubChem CID 11940283) has the molecular formula C21H28NO2+ and a molecular weight of 326.46 g/mol. Its IUPAC name is 4-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]methyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]methyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 11940283 |
| Molecular Formula | C21H28NO2+ |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 4-[[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinolin-2-ium-2-yl]methyl]-7,8-dimethylchromen-2-one |
| SMILES | Cc1ccc2c(C[NH+]3CC[C@@H]4CCCC[C@@H]4C3)cc(=O)oc2c1C |
| InChI | InChI=1S/C21H27NO2/c1-14-7-8-19-18(11-20(23)24-21(19)15(14)2)13-22-10-9-16-5-3-4-6-17(16)12-22/h7-8,11,16-17H,3-6,9-10,12-13H2,1-2H3/p+1/t16-,17+/m0/s1 |
| InChIKey | IKFSILNWZTYMEW-DLBZAZTESA-O |
| XLogP | 3.00 |
| TPSA | 34.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|