C24H27N2O4S+ — CID 2690568
7,8-dimethyl-4-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-ium-1-yl]methyl]chromen-2-one (PubChem CID 2690568) has the molecular formula C24H27N2O4S+ and a molecular weight of 439.56 g/mol. Its IUPAC name is 7,8-dimethyl-4-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-ium-1-yl]methyl]chromen-2-one.
| Compound Name | 7,8-dimethyl-4-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-ium-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 2690568 |
| Molecular Formula | C24H27N2O4S+ |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 7,8-dimethyl-4-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-ium-1-yl]methyl]chromen-2-one |
| SMILES | Cc1ccc2c(C[NH+]3CCN(S(=O)(=O)/C=C/c4ccccc4)CC3)cc(=O)oc2c1C |
| InChI | InChI=1S/C24H26N2O4S/c1-18-8-9-22-21(16-23(27)30-24(22)19(18)2)17-25-11-13-26(14-12-25)31(28,29)15-10-20-6-4-3-5-7-20/h3-10,15-16H,11-14,17H2,1-2H3/p+1/b15-10+ |
| InChIKey | LUBVTSKHSVTLAJ-XNTDXEJSSA-O |
| XLogP | 2.11 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|