C24H30N2O2+2 — CID 9256336
(1-benzylpiperidin-1-ium-4-yl)-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]azanium (PubChem CID 9256336) has the molecular formula C24H30N2O2+2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (1-benzylpiperidin-1-ium-4-yl)-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]azanium.
| Compound Name | (1-benzylpiperidin-1-ium-4-yl)-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 9256336 |
| Molecular Formula | C24H30N2O2+2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (1-benzylpiperidin-1-ium-4-yl)-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]azanium |
| SMILES | Cc1ccc2c(C[NH2+]C3CC[NH+](Cc4ccccc4)CC3)cc(=O)oc2c1C |
| InChI | InChI=1S/C24H28N2O2/c1-17-8-9-22-20(14-23(27)28-24(22)18(17)2)15-25-21-10-12-26(13-11-21)16-19-6-4-3-5-7-19/h3-9,14,21,25H,10-13,15-16H2,1-2H3/p+2 |
| InChIKey | WZCFJBAEFBNUKA-UHFFFAOYSA-P |
| XLogP | 1.72 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|