C22H25NO2 — CID 46269071
4-[[benzyl(propyl)amino]methyl]-7,8-dimethylchromen-2-one (PubChem CID 46269071) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 4-[[benzyl(propyl)amino]methyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[[benzyl(propyl)amino]methyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 46269071 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 4-[[benzyl(propyl)amino]methyl]-7,8-dimethylchromen-2-one |
| SMILES | CCCN(Cc1ccccc1)Cc1cc(=O)oc2c(C)c(C)ccc12 |
| InChI | InChI=1S/C22H25NO2/c1-4-12-23(14-18-8-6-5-7-9-18)15-19-13-21(24)25-22-17(3)16(2)10-11-20(19)22/h5-11,13H,4,12,14-15H2,1-3H3 |
| InChIKey | WDBMBRDJRHJDKI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|