C25H27N3O3 — CID 135809150
2-[[butyl-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]amino]methyl]-3H-quinazolin-4-one (PubChem CID 135809150) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-[[butyl-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]amino]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[butyl-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]amino]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135809150 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-[[butyl-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]amino]methyl]-3H-quinazolin-4-one |
| SMILES | CCCCN(Cc1nc2ccccc2c(=O)[nH]1)Cc1cc(=O)oc2c(C)c(C)ccc12 |
| InChI | InChI=1S/C25H27N3O3/c1-4-5-12-28(15-22-26-21-9-7-6-8-20(21)25(30)27-22)14-18-13-23(29)31-24-17(3)16(2)10-11-19(18)24/h6-11,13H,4-5,12,14-15H2,1-3H3,(H,26,27,30) |
| InChIKey | DTSYPLMFBWRCBU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|