C12H11BrO2 — CID 91484430
4-(bromomethyl)-7,8-dimethylchromen-2-one (PubChem CID 91484430) has the molecular formula C12H11BrO2 and a molecular weight of 267.12 g/mol. Its IUPAC name is 4-(bromomethyl)-7,8-dimethylchromen-2-one.
| Compound Name | 4-(bromomethyl)-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 91484430 |
| Molecular Formula | C12H11BrO2 |
| Molecular Weight | 267.12 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 4-(bromomethyl)-7,8-dimethylchromen-2-one |
| SMILES | Cc1ccc2c(CBr)cc(=O)oc2c1C |
| InChI | InChI=1S/C12H11BrO2/c1-7-3-4-10-9(6-13)5-11(14)15-12(10)8(7)2/h3-5H,6H2,1-2H3 |
| InChIKey | GXONONZYAXRJFL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.12 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|