C19H15NO2S — CID 56569593
4-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]benzonitrile (PubChem CID 56569593) has the molecular formula C19H15NO2S and a molecular weight of 321.40 g/mol. Its IUPAC name is 4-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]benzonitrile.
| Compound Name | 4-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]benzonitrile |
|---|---|
| PubChem CID | 56569593 |
| Molecular Formula | C19H15NO2S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 4-[(7,8-dimethyl-2-oxochromen-4-yl)methylsulfanyl]benzonitrile |
| SMILES | Cc1ccc2c(CSc3ccc(C#N)cc3)cc(=O)oc2c1C |
| InChI | InChI=1S/C19H15NO2S/c1-12-3-8-17-15(9-18(21)22-19(17)13(12)2)11-23-16-6-4-14(10-20)5-7-16/h3-9H,11H2,1-2H3 |
| InChIKey | KDJMJBSFKZMRGM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 54.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|