C21H17ClN2O4S — CID 31635262
4-[[5-[(4-chlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one (PubChem CID 31635262) has the molecular formula C21H17ClN2O4S and a molecular weight of 428.90 g/mol. Its IUPAC name is 4-[[5-[(4-chlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[[5-[(4-chlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 31635262 |
| Molecular Formula | C21H17ClN2O4S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 4-[[5-[(4-chlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-7,8-dimethylchromen-2-one |
| SMILES | Cc1ccc2c(CSc3nnc(COc4ccc(Cl)cc4)o3)cc(=O)oc2c1C |
| InChI | InChI=1S/C21H17ClN2O4S/c1-12-3-8-17-14(9-19(25)28-20(17)13(12)2)11-29-21-24-23-18(27-21)10-26-16-6-4-15(22)5-7-16/h3-9H,10-11H2,1-2H3 |
| InChIKey | HIOXQPDUWAENJI-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|