C20H20ClNO3 — CID 8718859
4-[[2-(4-chlorophenoxy)ethylamino]methyl]-7,8-dimethylchromen-2-one (PubChem CID 8718859) has the molecular formula C20H20ClNO3 and a molecular weight of 357.84 g/mol. Its IUPAC name is 4-[[2-(4-chlorophenoxy)ethylamino]methyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[[2-(4-chlorophenoxy)ethylamino]methyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 8718859 |
| Molecular Formula | C20H20ClNO3 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 4-[[2-(4-chlorophenoxy)ethylamino]methyl]-7,8-dimethylchromen-2-one |
| SMILES | Cc1ccc2c(CNCCOc3ccc(Cl)cc3)cc(=O)oc2c1C |
| InChI | InChI=1S/C20H20ClNO3/c1-13-3-8-18-15(11-19(23)25-20(18)14(13)2)12-22-9-10-24-17-6-4-16(21)5-7-17/h3-8,11,22H,9-10,12H2,1-2H3 |
| InChIKey | LSWMSPCPIYUGEN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|