C19H18ClNO3 — CID 9346165
4-[(5-chloro-2-methoxyanilino)methyl]-7,8-dimethylchromen-2-one (PubChem CID 9346165) has the molecular formula C19H18ClNO3 and a molecular weight of 343.81 g/mol. Its IUPAC name is 4-[(5-chloro-2-methoxyanilino)methyl]-7,8-dimethylchromen-2-one.
| Compound Name | 4-[(5-chloro-2-methoxyanilino)methyl]-7,8-dimethylchromen-2-one |
|---|---|
| PubChem CID | 9346165 |
| Molecular Formula | C19H18ClNO3 |
| Molecular Weight | 343.81 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 4-[(5-chloro-2-methoxyanilino)methyl]-7,8-dimethylchromen-2-one |
| SMILES | COc1ccc(Cl)cc1NCc1cc(=O)oc2c(C)c(C)ccc12 |
| InChI | InChI=1S/C19H18ClNO3/c1-11-4-6-15-13(8-18(22)24-19(15)12(11)2)10-21-16-9-14(20)5-7-17(16)23-3/h4-9,21H,10H2,1-3H3 |
| InChIKey | ZLEFPBLSQIAOJY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.81 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|