C20H19FN2O3 — CID 34067725
N-[3-[(7,8-dimethyl-2-oxochromen-4-yl)methylamino]-4-fluorophenyl]acetamide (PubChem CID 34067725) has the molecular formula C20H19FN2O3 and a molecular weight of 354.38 g/mol. Its IUPAC name is N-[3-[(7,8-dimethyl-2-oxochromen-4-yl)methylamino]-4-fluorophenyl]acetamide.
| Compound Name | N-[3-[(7,8-dimethyl-2-oxochromen-4-yl)methylamino]-4-fluorophenyl]acetamide |
|---|---|
| PubChem CID | 34067725 |
| Molecular Formula | C20H19FN2O3 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-[3-[(7,8-dimethyl-2-oxochromen-4-yl)methylamino]-4-fluorophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(F)c(NCc2cc(=O)oc3c(C)c(C)ccc23)c1 |
| InChI | InChI=1S/C20H19FN2O3/c1-11-4-6-16-14(8-19(25)26-20(16)12(11)2)10-22-18-9-15(23-13(3)24)5-7-17(18)21/h4-9,22H,10H2,1-3H3,(H,23,24) |
| InChIKey | IKBFZVNFTVHJLQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|