C24H22N2O4 — CID 9347174
2-[(7,8-dimethyl-2-oxochromen-4-yl)methylamino]-N-(furan-2-ylmethyl)benzamide (PubChem CID 9347174) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-[(7,8-dimethyl-2-oxochromen-4-yl)methylamino]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 2-[(7,8-dimethyl-2-oxochromen-4-yl)methylamino]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 9347174 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-[(7,8-dimethyl-2-oxochromen-4-yl)methylamino]-N-(furan-2-ylmethyl)benzamide |
| SMILES | Cc1ccc2c(CNc3ccccc3C(=O)NCc3ccco3)cc(=O)oc2c1C |
| InChI | InChI=1S/C24H22N2O4/c1-15-9-10-19-17(12-22(27)30-23(19)16(15)2)13-25-21-8-4-3-7-20(21)24(28)26-14-18-6-5-11-29-18/h3-12,25H,13-14H2,1-2H3,(H,26,28) |
| InChIKey | DBZPTWQYPQXSMO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|