C22H22NO4+ — CID 8841537
(7,8-dimethyl-2-oxochromen-4-yl)methyl-bis(furan-2-ylmethyl)azanium (PubChem CID 8841537) has the molecular formula C22H22NO4+ and a molecular weight of 364.42 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl-bis(furan-2-ylmethyl)azanium.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-bis(furan-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8841537 |
| Molecular Formula | C22H22NO4+ |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-bis(furan-2-ylmethyl)azanium |
| SMILES | Cc1ccc2c(C[NH+](Cc3ccco3)Cc3ccco3)cc(=O)oc2c1C |
| InChI | InChI=1S/C22H21NO4/c1-15-7-8-20-17(11-21(24)27-22(20)16(15)2)12-23(13-18-5-3-9-25-18)14-19-6-4-10-26-19/h3-11H,12-14H2,1-2H3/p+1 |
| InChIKey | QVCZSCWPHXXLCV-UHFFFAOYSA-O |
| XLogP | 3.38 |
| TPSA | 60.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|