C18H20NO2S+ — CID 8516925
(7,8-dimethyl-2-oxochromen-4-yl)methyl-methyl-(thiophen-2-ylmethyl)azanium (PubChem CID 8516925) has the molecular formula C18H20NO2S+ and a molecular weight of 314.43 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl-methyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-methyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8516925 |
| Molecular Formula | C18H20NO2S+ |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-methyl-(thiophen-2-ylmethyl)azanium |
| SMILES | Cc1ccc2c(C[NH+](C)Cc3cccs3)cc(=O)oc2c1C |
| InChI | InChI=1S/C18H19NO2S/c1-12-6-7-16-14(9-17(20)21-18(16)13(12)2)10-19(3)11-15-5-4-8-22-15/h4-9H,10-11H2,1-3H3/p+1 |
| InChIKey | YPBDKENKJHJLDT-UHFFFAOYSA-O |
| XLogP | 2.69 |
| TPSA | 34.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|