C22H26NO4+ — CID 2689355
(2,4-dimethoxyphenyl)methyl-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]-methylazanium (PubChem CID 2689355) has the molecular formula C22H26NO4+ and a molecular weight of 368.45 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)methyl-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]-methylazanium.
| Compound Name | (2,4-dimethoxyphenyl)methyl-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 2689355 |
| Molecular Formula | C22H26NO4+ |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (2,4-dimethoxyphenyl)methyl-[(7,8-dimethyl-2-oxochromen-4-yl)methyl]-methylazanium |
| SMILES | COc1ccc(C[NH+](C)Cc2cc(=O)oc3c(C)c(C)ccc23)c(OC)c1 |
| InChI | InChI=1S/C22H25NO4/c1-14-6-9-19-17(10-21(24)27-22(19)15(14)2)13-23(3)12-16-7-8-18(25-4)11-20(16)26-5/h6-11H,12-13H2,1-5H3/p+1 |
| InChIKey | JXFXIJQKOUNFCS-UHFFFAOYSA-O |
| XLogP | 2.64 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|