C18H25N2O3+ — CID 9302633
(7,8-dimethyl-2-oxochromen-4-yl)methyl-methyl-[2-oxo-2-(propylamino)ethyl]azanium (PubChem CID 9302633) has the molecular formula C18H25N2O3+ and a molecular weight of 317.41 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl-methyl-[2-oxo-2-(propylamino)ethyl]azanium.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-methyl-[2-oxo-2-(propylamino)ethyl]azanium |
|---|---|
| PubChem CID | 9302633 |
| Molecular Formula | C18H25N2O3+ |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl-methyl-[2-oxo-2-(propylamino)ethyl]azanium |
| SMILES | CCCNC(=O)C[NH+](C)Cc1cc(=O)oc2c(C)c(C)ccc12 |
| InChI | InChI=1S/C18H24N2O3/c1-5-8-19-16(21)11-20(4)10-14-9-17(22)23-18-13(3)12(2)6-7-15(14)18/h6-7,9H,5,8,10-11H2,1-4H3,(H,19,21)/p+1 |
| InChIKey | XQALRAJKKDXDGO-UHFFFAOYSA-O |
| XLogP | 0.95 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|