C16H26N3O2+ — CID 8791084
methyl-[(2-methylphenyl)methyl]-[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl]azanium (PubChem CID 8791084) has the molecular formula C16H26N3O2+ and a molecular weight of 292.40 g/mol. Its IUPAC name is methyl-[(2-methylphenyl)methyl]-[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl]azanium.
| Compound Name | methyl-[(2-methylphenyl)methyl]-[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 8791084 |
| Molecular Formula | C16H26N3O2+ |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | methyl-[(2-methylphenyl)methyl]-[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl]azanium |
| SMILES | CCCNC(=O)CNC(=O)C[NH+](C)Cc1ccccc1C |
| InChI | InChI=1S/C16H25N3O2/c1-4-9-17-15(20)10-18-16(21)12-19(3)11-14-8-6-5-7-13(14)2/h5-8H,4,9-12H2,1-3H3,(H,17,20)(H,18,21)/p+1 |
| InChIKey | GGNFQUHEVHKJRT-UHFFFAOYSA-O |
| XLogP | -0.35 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |