C19H25N2O+ — CID 9302756
methyl-[2-oxo-2-(propylamino)ethyl]-[(4-phenylphenyl)methyl]azanium (PubChem CID 9302756) has the molecular formula C19H25N2O+ and a molecular weight of 297.42 g/mol. Its IUPAC name is methyl-[2-oxo-2-(propylamino)ethyl]-[(4-phenylphenyl)methyl]azanium.
| Compound Name | methyl-[2-oxo-2-(propylamino)ethyl]-[(4-phenylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9302756 |
| Molecular Formula | C19H25N2O+ |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | methyl-[2-oxo-2-(propylamino)ethyl]-[(4-phenylphenyl)methyl]azanium |
| SMILES | CCCNC(=O)C[NH+](C)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H24N2O/c1-3-13-20-19(22)15-21(2)14-16-9-11-18(12-10-16)17-7-5-4-6-8-17/h4-12H,3,13-15H2,1-2H3,(H,20,22)/p+1 |
| InChIKey | WNHMOSXMVGBISJ-UHFFFAOYSA-O |
| XLogP | 1.89 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |