C17H19NO — CID 175085430
bicyclo[2.2.0]hexa-1,3,5-triene;2-phenyl-N-propylacetamide (PubChem CID 175085430) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;2-phenyl-N-propylacetamide.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;2-phenyl-N-propylacetamide |
|---|---|
| PubChem CID | 175085430 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;2-phenyl-N-propylacetamide |
| SMILES | CCCNC(=O)Cc1ccccc1.c1cc2ccc1-2 |
| InChI | InChI=1S/C11H15NO.C6H4/c1-2-8-12-11(13)9-10-6-4-3-5-7-10;1-2-6-4-3-5(1)6/h3-7H,2,8-9H2,1H3,(H,12,13);1-4H |
| InChIKey | TYTKOHQUJNQRAH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |