About benzene;molecular hydrogen;2-phenyl-N-propylacetamide
benzene;molecular hydrogen;2-phenyl-N-propylacetamide (PubChem CID 144955399) has the molecular formula C17H23NO
and a molecular weight of 257.38 g/mol. Its IUPAC name is benzene;molecular hydrogen;2-phenyl-N-propylacetamide.
Molecular Properties
| Compound Name | benzene;molecular hydrogen;2-phenyl-N-propylacetamide |
| PubChem CID | 144955399 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | benzene;molecular hydrogen;2-phenyl-N-propylacetamide |
| SMILES | CCCNC(=O)Cc1ccccc1.[H][H].c1ccccc1 |
| InChI | InChI=1S/C11H15NO.C6H6.H2/c1-2-8-12-11(13)9-10-6-4-3-5-7-10;1-2-4-6-5-3-1;/h3-7H,2,8-9H2,1H3,(H,12,13);1-6H;1H |
| InChIKey | OWCQKFBMGFYGLE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;molecular hydrogen;2-phenyl-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;molecular hydrogen;2-phenyl-N-propylacetamide?
The IUPAC name of benzene;molecular hydrogen;2-phenyl-N-propylacetamide (CID 144955399) is benzene;molecular hydrogen;2-phenyl-N-propylacetamide.
What is the SMILES notation for benzene;molecular hydrogen;2-phenyl-N-propylacetamide?
The canonical SMILES for benzene;molecular hydrogen;2-phenyl-N-propylacetamide is CCCNC(=O)Cc1ccccc1.[H][H].c1ccccc1.
What is the InChIKey of benzene;molecular hydrogen;2-phenyl-N-propylacetamide?
The InChIKey is OWCQKFBMGFYGLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO.C6H6.H2/c1-2-8-12-11(13)9-10-6-4-3-5-7-10;1-2-4-6-5-3-1;/h3-7H,2,8-9H2,1H3,(H,12,13);1-6H;1H.
What are the key properties of benzene;molecular hydrogen;2-phenyl-N-propylacetamide?
benzene;molecular hydrogen;2-phenyl-N-propylacetamide has a molecular weight of 257.38 g/mol, XLogP of 3.69, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;molecular hydrogen;2-phenyl-N-propylacetamide is sourced from PubChem (CID 144955399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).