molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide

C12H17NO2 — CID 144547081

IUPACmolecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide
SMILESCCC(=O)CNC(=O)Cc1ccccc1.[H][H]
InChIInChI=1S/C12H15NO2.H2/c1-2-11(14)9-13-12(15)8-10-6-4-3-5-7-10;/h3-7H,2,8-9H2,1H3,(H,13,15);1H
InChIKeyIRWORVBZQWDJDF-UHFFFAOYSA-N
MW207.27 g/mol
LogP1.57
Rot. Bonds5

About molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide

molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide (PubChem CID 144547081) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide.

Molecular Properties

Compound Namemolecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide
PubChem CID144547081
Molecular FormulaC12H17NO2
Molecular Weight207.27 g/mol
Exact Mass207.13
IUPAC Namemolecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide
SMILESCCC(=O)CNC(=O)Cc1ccccc1.[H][H]
InChIInChI=1S/C12H15NO2.H2/c1-2-11(14)9-13-12(15)8-10-6-4-3-5-7-10;/h3-7H,2,8-9H2,1H3,(H,13,15);1H
InChIKeyIRWORVBZQWDJDF-UHFFFAOYSA-N
XLogP1.57
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.27
LogP ≤ 51.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide?
The IUPAC name of molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide (CID 144547081) is molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide.
What is the SMILES notation for molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide?
The canonical SMILES for molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide is CCC(=O)CNC(=O)Cc1ccccc1.[H][H].
What is the InChIKey of molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide?
The InChIKey is IRWORVBZQWDJDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2.H2/c1-2-11(14)9-13-12(15)8-10-6-4-3-5-7-10;/h3-7H,2,8-9H2,1H3,(H,13,15);1H.
What are the key properties of molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide?
molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide has a molecular weight of 207.27 g/mol, XLogP of 1.57, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide is sourced from PubChem (CID 144547081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).