C12H17NO2 — CID 144547081
molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide (PubChem CID 144547081) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide.
| Compound Name | molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 144547081 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | molecular hydrogen;N-(2-oxobutyl)-2-phenylacetamide |
| SMILES | CCC(=O)CNC(=O)Cc1ccccc1.[H][H] |
| InChI | InChI=1S/C12H15NO2.H2/c1-2-11(14)9-13-12(15)8-10-6-4-3-5-7-10;/h3-7H,2,8-9H2,1H3,(H,13,15);1H |
| InChIKey | IRWORVBZQWDJDF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |