C12H21NO — CID 167457544
ethane;N-ethyl-2-phenylacetamide;molecular hydrogen (PubChem CID 167457544) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is ethane;N-ethyl-2-phenylacetamide;molecular hydrogen.
| Compound Name | ethane;N-ethyl-2-phenylacetamide;molecular hydrogen |
|---|---|
| PubChem CID | 167457544 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | ethane;N-ethyl-2-phenylacetamide;molecular hydrogen |
| SMILES | CC.CCNC(=O)Cc1ccccc1.[H][H] |
| InChI | InChI=1S/C10H13NO.C2H6.H2/c1-2-11-10(12)8-9-6-4-3-5-7-9;1-2;/h3-7H,2,8H2,1H3,(H,11,12);1-2H3;1H |
| InChIKey | SRQSHFCNTKZXON-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |