About 2-[4-[2-(2,2-dimethylpropylamino)-2-oxoethyl]phenyl]-N-ethylacetamide;ethane;propane
2-[4-[2-(2,2-dimethylpropylamino)-2-oxoethyl]phenyl]-N-ethylacetamide;ethane;propane (PubChem CID 170603085) has the molecular formula C22H40N2O2
and a molecular weight of 364.57 g/mol. Its IUPAC name is 2-[4-[2-(2,2-dimethylpropylamino)-2-oxoethyl]phenyl]-N-ethylacetamide;ethane;propane.
Molecular Properties
| Compound Name | 2-[4-[2-(2,2-dimethylpropylamino)-2-oxoethyl]phenyl]-N-ethylacetamide;ethane;propane |
| PubChem CID | 170603085 |
| Molecular Formula | C22H40N2O2 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.31 |
| IUPAC Name | 2-[4-[2-(2,2-dimethylpropylamino)-2-oxoethyl]phenyl]-N-ethylacetamide;ethane;propane |
| SMILES | CC.CCC.CCNC(=O)Cc1ccc(CC(=O)NCC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H26N2O2.C3H8.C2H6/c1-5-18-15(20)10-13-6-8-14(9-7-13)11-16(21)19-12-17(2,3)4;1-3-2;1-2/h6-9H,5,10-12H2,1-4H3,(H,18,20)(H,19,21);3H2,1-2H3;1-2H3 |
| InChIKey | AAAVMCKKFXSTDE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[4-[2-(2,2-dimethylpropylamino)-2-oxoethyl]phenyl]-N-ethylacetamide;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(2,2-dimethylpropylamino)-2-oxoethyl]phenyl]-N-ethylacetamide;ethane;propane?
The IUPAC name of 2-[4-[2-(2,2-dimethylpropylamino)-2-oxoethyl]phenyl]-N-ethylacetamide;ethane;propane (CID 170603085) is 2-[4-[2-(2,2-dimethylpropylamino)-2-oxoethyl]phenyl]-N-ethylacetamide;ethane;propane.
What is the SMILES notation for 2-[4-[2-(2,2-dimethylpropylamino)-2-oxoethyl]phenyl]-N-ethylacetamide;ethane;propane?
The canonical SMILES for 2-[4-[2-(2,2-dimethylpropylamino)-2-oxoethyl]phenyl]-N-ethylacetamide;ethane;propane is CC.CCC.CCNC(=O)Cc1ccc(CC(=O)NCC(C)(C)C)cc1.
What is the InChIKey of 2-[4-[2-(2,2-dimethylpropylamino)-2-oxoethyl]phenyl]-N-ethylacetamide;ethane;propane?
The InChIKey is AAAVMCKKFXSTDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O2.C3H8.C2H6/c1-5-18-15(20)10-13-6-8-14(9-7-13)11-16(21)19-12-17(2,3)4;1-3-2;1-2/h6-9H,5,10-12H2,1-4H3,(H,18,20)(H,19,21);3H2,1-2H3;1-2H3.
What are the key properties of 2-[4-[2-(2,2-dimethylpropylamino)-2-oxoethyl]phenyl]-N-ethylacetamide;ethane;propane?
2-[4-[2-(2,2-dimethylpropylamino)-2-oxoethyl]phenyl]-N-ethylacetamide;ethane;propane has a molecular weight of 364.57 g/mol, XLogP of 4.51, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(2,2-dimethylpropylamino)-2-oxoethyl]phenyl]-N-ethylacetamide;ethane;propane is sourced from PubChem (CID 170603085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).