C17H25N3O — CID 115743112
2-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]-N-ethylacetamide (PubChem CID 115743112) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]-N-ethylacetamide.
| Compound Name | 2-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 115743112 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 2-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]-N-ethylacetamide |
| SMILES | CCNC(=O)Cc1ccc(NCC(C)(C)CCC#N)cc1 |
| InChI | InChI=1S/C17H25N3O/c1-4-19-16(21)12-14-6-8-15(9-7-14)20-13-17(2,3)10-5-11-18/h6-9,20H,4-5,10,12-13H2,1-3H3,(H,19,21) |
| InChIKey | MJFBWOTXLFDQMF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |