About methyl N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]carbamate
methyl N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]carbamate (PubChem CID 115743193) has the molecular formula C15H21N3O2
and a molecular weight of 275.35 g/mol. Its IUPAC name is methyl N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]carbamate |
| PubChem CID | 115743193 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | methyl N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(NCC(C)(C)CCC#N)cc1 |
| InChI | InChI=1S/C15H21N3O2/c1-15(2,9-4-10-16)11-17-12-5-7-13(8-6-12)18-14(19)20-3/h5-8,17H,4,9,11H2,1-3H3,(H,18,19) |
| InChIKey | BOIWTBAOYDHXMI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]carbamate?
The IUPAC name of methyl N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]carbamate (CID 115743193) is methyl N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]carbamate.
What is the SMILES notation for methyl N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]carbamate?
The canonical SMILES for methyl N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]carbamate is COC(=O)Nc1ccc(NCC(C)(C)CCC#N)cc1.
What is the InChIKey of methyl N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]carbamate?
The InChIKey is BOIWTBAOYDHXMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O2/c1-15(2,9-4-10-16)11-17-12-5-7-13(8-6-12)18-14(19)20-3/h5-8,17H,4,9,11H2,1-3H3,(H,18,19).
What are the key properties of methyl N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]carbamate?
methyl N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]carbamate has a molecular weight of 275.35 g/mol, XLogP of 3.61, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]carbamate is sourced from PubChem (CID 115743193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).