C14H17F3N2O — CID 115743231
5-[4-(difluoromethoxy)-3-fluoroanilino]-4,4-dimethylpentanenitrile (PubChem CID 115743231) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is 5-[4-(difluoromethoxy)-3-fluoroanilino]-4,4-dimethylpentanenitrile.
| Compound Name | 5-[4-(difluoromethoxy)-3-fluoroanilino]-4,4-dimethylpentanenitrile |
|---|---|
| PubChem CID | 115743231 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 5-[4-(difluoromethoxy)-3-fluoroanilino]-4,4-dimethylpentanenitrile |
| SMILES | CC(C)(CCC#N)CNc1ccc(OC(F)F)c(F)c1 |
| InChI | InChI=1S/C14H17F3N2O/c1-14(2,6-3-7-18)9-19-10-4-5-12(11(15)8-10)20-13(16)17/h4-5,8,13,19H,3,6,9H2,1-2H3 |
| InChIKey | FVQKUIMSABRKMW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|