C14H15F3N2O — CID 66415167
4-(difluoromethoxy)-N-[(1-ethylpyrrol-3-yl)methyl]-3-fluoroaniline (PubChem CID 66415167) has the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[(1-ethylpyrrol-3-yl)methyl]-3-fluoroaniline.
| Compound Name | 4-(difluoromethoxy)-N-[(1-ethylpyrrol-3-yl)methyl]-3-fluoroaniline |
|---|---|
| PubChem CID | 66415167 |
| Molecular Formula | C14H15F3N2O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-(difluoromethoxy)-N-[(1-ethylpyrrol-3-yl)methyl]-3-fluoroaniline |
| SMILES | CCn1ccc(CNc2ccc(OC(F)F)c(F)c2)c1 |
| InChI | InChI=1S/C14H15F3N2O/c1-2-19-6-5-10(9-19)8-18-11-3-4-13(12(15)7-11)20-14(16)17/h3-7,9,14,18H,2,8H2,1H3 |
| InChIKey | YSZSCNGWGMWIAP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|