C10H12F3NO — CID 60942479
4-(difluoromethoxy)-3-fluoro-N-propylaniline (PubChem CID 60942479) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-fluoro-N-propylaniline.
| Compound Name | 4-(difluoromethoxy)-3-fluoro-N-propylaniline |
|---|---|
| PubChem CID | 60942479 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 4-(difluoromethoxy)-3-fluoro-N-propylaniline |
| SMILES | CCCNc1ccc(OC(F)F)c(F)c1 |
| InChI | InChI=1S/C10H12F3NO/c1-2-5-14-7-3-4-9(8(11)6-7)15-10(12)13/h3-4,6,10,14H,2,5H2,1H3 |
| InChIKey | GTJQJYLHUNYVTM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|