C14H21N3O2S — CID 115743549
N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]methanesulfonamide (PubChem CID 115743549) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 115743549 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-[4-[(4-cyano-2,2-dimethylbutyl)amino]phenyl]methanesulfonamide |
| SMILES | CC(C)(CCC#N)CNc1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H21N3O2S/c1-14(2,9-4-10-15)11-16-12-5-7-13(8-6-12)17-20(3,18)19/h5-8,16-17H,4,9,11H2,1-3H3 |
| InChIKey | NKRSBCMLKTVTTN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |