C11H22N2O2S — CID 115653244
5-(2-ethylsulfonylethylamino)-4,4-dimethylpentanenitrile (PubChem CID 115653244) has the molecular formula C11H22N2O2S and a molecular weight of 246.38 g/mol. Its IUPAC name is 5-(2-ethylsulfonylethylamino)-4,4-dimethylpentanenitrile.
| Compound Name | 5-(2-ethylsulfonylethylamino)-4,4-dimethylpentanenitrile |
|---|---|
| PubChem CID | 115653244 |
| Molecular Formula | C11H22N2O2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 5-(2-ethylsulfonylethylamino)-4,4-dimethylpentanenitrile |
| SMILES | CCS(=O)(=O)CCNCC(C)(C)CCC#N |
| InChI | InChI=1S/C11H22N2O2S/c1-4-16(14,15)9-8-13-10-11(2,3)6-5-7-12/h13H,4-6,8-10H2,1-3H3 |
| InChIKey | OALCFKIOHXOCLX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|