C11H25NO3S — CID 62726162
4-ethylsulfonyl-N-(2-methoxyethyl)-2,2-dimethylbutan-1-amine (PubChem CID 62726162) has the molecular formula C11H25NO3S and a molecular weight of 251.39 g/mol. Its IUPAC name is 4-ethylsulfonyl-N-(2-methoxyethyl)-2,2-dimethylbutan-1-amine.
| Compound Name | 4-ethylsulfonyl-N-(2-methoxyethyl)-2,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 62726162 |
| Molecular Formula | C11H25NO3S |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 4-ethylsulfonyl-N-(2-methoxyethyl)-2,2-dimethylbutan-1-amine |
| SMILES | CCS(=O)(=O)CCC(C)(C)CNCCOC |
| InChI | InChI=1S/C11H25NO3S/c1-5-16(13,14)9-6-11(2,3)10-12-7-8-15-4/h12H,5-10H2,1-4H3 |
| InChIKey | ICENAVADRSBWLV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|