C11H24ClNO2S — CID 106140512
4-chloro-N-(3-ethylsulfonylpropyl)-2,2-dimethylbutan-1-amine (PubChem CID 106140512) has the molecular formula C11H24ClNO2S and a molecular weight of 269.84 g/mol. Its IUPAC name is 4-chloro-N-(3-ethylsulfonylpropyl)-2,2-dimethylbutan-1-amine.
| Compound Name | 4-chloro-N-(3-ethylsulfonylpropyl)-2,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 106140512 |
| Molecular Formula | C11H24ClNO2S |
| Molecular Weight | 269.84 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-chloro-N-(3-ethylsulfonylpropyl)-2,2-dimethylbutan-1-amine |
| SMILES | CCS(=O)(=O)CCCNCC(C)(C)CCCl |
| InChI | InChI=1S/C11H24ClNO2S/c1-4-16(14,15)9-5-8-13-10-11(2,3)6-7-12/h13H,4-10H2,1-3H3 |
| InChIKey | LGHANXTZUVHSNO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.84 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|