C13H29NO2S — CID 81022072
6-ethylsulfonyl-3,3-dimethyl-N-propylhexan-1-amine (PubChem CID 81022072) has the molecular formula C13H29NO2S and a molecular weight of 263.45 g/mol. Its IUPAC name is 6-ethylsulfonyl-3,3-dimethyl-N-propylhexan-1-amine.
| Compound Name | 6-ethylsulfonyl-3,3-dimethyl-N-propylhexan-1-amine |
|---|---|
| PubChem CID | 81022072 |
| Molecular Formula | C13H29NO2S |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 6-ethylsulfonyl-3,3-dimethyl-N-propylhexan-1-amine |
| SMILES | CCCNCCC(C)(C)CCCS(=O)(=O)CC |
| InChI | InChI=1S/C13H29NO2S/c1-5-10-14-11-9-13(3,4)8-7-12-17(15,16)6-2/h14H,5-12H2,1-4H3 |
| InChIKey | AYGNGZUUJGIAJH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|