C12H23N3O — CID 115653050
3-[(4-cyano-2,2-dimethylbutyl)amino]-N,N-dimethylpropanamide (PubChem CID 115653050) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 3-[(4-cyano-2,2-dimethylbutyl)amino]-N,N-dimethylpropanamide.
| Compound Name | 3-[(4-cyano-2,2-dimethylbutyl)amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 115653050 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 3-[(4-cyano-2,2-dimethylbutyl)amino]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCNCC(C)(C)CCC#N |
| InChI | InChI=1S/C12H23N3O/c1-12(2,7-5-8-13)10-14-9-6-11(16)15(3)4/h14H,5-7,9-10H2,1-4H3 |
| InChIKey | AFJUOEHVINULMV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|