C9H16N2O — CID 63656065
3-(but-3-ynylamino)-N,N-dimethylpropanamide (PubChem CID 63656065) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-(but-3-ynylamino)-N,N-dimethylpropanamide.
| Compound Name | 3-(but-3-ynylamino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 63656065 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 3-(but-3-ynylamino)-N,N-dimethylpropanamide |
| SMILES | C#CCCNCCC(=O)N(C)C |
| InChI | InChI=1S/C9H16N2O/c1-4-5-7-10-8-6-9(12)11(2)3/h1,10H,5-8H2,2-3H3 |
| InChIKey | PLPVFFYMOIMDMI-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|