C7H17N3O — CID 62141656
3-(2-aminoethylamino)-N,N-dimethylpropanamide (PubChem CID 62141656) has the molecular formula C7H17N3O and a molecular weight of 159.23 g/mol. Its IUPAC name is 3-(2-aminoethylamino)-N,N-dimethylpropanamide.
| Compound Name | 3-(2-aminoethylamino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 62141656 |
| Molecular Formula | C7H17N3O |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | 3-(2-aminoethylamino)-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CCNCCN |
| InChI | InChI=1S/C7H17N3O/c1-10(2)7(11)3-5-9-6-4-8/h9H,3-6,8H2,1-2H3 |
| InChIKey | CFEORHRYBCMWSQ-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|