C7H16N2O — CID 60926487
3-(ethylamino)-N,N-dimethylpropanamide (PubChem CID 60926487) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is 3-(ethylamino)-N,N-dimethylpropanamide.
| Compound Name | 3-(ethylamino)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 60926487 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 3-(ethylamino)-N,N-dimethylpropanamide |
| SMILES | CCNCCC(=O)N(C)C |
| InChI | InChI=1S/C7H16N2O/c1-4-8-6-5-7(10)9(2)3/h8H,4-6H2,1-3H3 |
| InChIKey | NEGDLSFFPNQBPZ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|