C11H24N2O — CID 60926846
N,N-dimethyl-3-(2-methylpentylamino)propanamide (PubChem CID 60926846) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is N,N-dimethyl-3-(2-methylpentylamino)propanamide.
| Compound Name | N,N-dimethyl-3-(2-methylpentylamino)propanamide |
|---|---|
| PubChem CID | 60926846 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | N,N-dimethyl-3-(2-methylpentylamino)propanamide |
| SMILES | CCCC(C)CNCCC(=O)N(C)C |
| InChI | InChI=1S/C11H24N2O/c1-5-6-10(2)9-12-8-7-11(14)13(3)4/h10,12H,5-9H2,1-4H3 |
| InChIKey | YHQUHGGPSQHIAZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|