C9H19NO — CID 170848594
(3R)-N,N,3-trimethylhexanamide (PubChem CID 170848594) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is (3R)-N,N,3-trimethylhexanamide.
| Compound Name | (3R)-N,N,3-trimethylhexanamide |
|---|---|
| PubChem CID | 170848594 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (3R)-N,N,3-trimethylhexanamide |
| SMILES | CCC[C@@H](C)CC(=O)N(C)C |
| InChI | InChI=1S/C9H19NO/c1-5-6-8(2)7-9(11)10(3)4/h8H,5-7H2,1-4H3/t8-/m1/s1 |
| InChIKey | MOULBLFNCXLFGK-MRVPVSSYSA-N |
| XLogP | 1.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |