C19H38N2O2 — CID 166236777
N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide (PubChem CID 166236777) has the molecular formula C19H38N2O2 and a molecular weight of 326.53 g/mol. Its IUPAC name is N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide.
| Compound Name | N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide |
|---|---|
| PubChem CID | 166236777 |
| Molecular Formula | C19H38N2O2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide |
| SMILES | CCN(C(=O)CCC(C)CC(=O)N(CC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H38N2O2/c1-10-20(18(4,5)6)16(22)13-12-15(3)14-17(23)21(11-2)19(7,8)9/h15H,10-14H2,1-9H3 |
| InChIKey | HTZPYRARNCPVTD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |