About N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide
N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide (PubChem CID 166236777) has the molecular formula C19H38N2O2
and a molecular weight of 326.53 g/mol. Its IUPAC name is N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide.
Molecular Properties
| Compound Name | N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide |
| PubChem CID | 166236777 |
| Molecular Formula | C19H38N2O2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide |
| SMILES | CCN(C(=O)CCC(C)CC(=O)N(CC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H38N2O2/c1-10-20(18(4,5)6)16(22)13-12-15(3)14-17(23)21(11-2)19(7,8)9/h15H,10-14H2,1-9H3 |
| InChIKey | HTZPYRARNCPVTD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide?
The IUPAC name of N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide (CID 166236777) is N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide.
What is the SMILES notation for N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide?
The canonical SMILES for N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide is CCN(C(=O)CCC(C)CC(=O)N(CC)C(C)(C)C)C(C)(C)C.
What is the InChIKey of N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide?
The InChIKey is HTZPYRARNCPVTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38N2O2/c1-10-20(18(4,5)6)16(22)13-12-15(3)14-17(23)21(11-2)19(7,8)9/h15H,10-14H2,1-9H3.
What are the key properties of N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide?
N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide has a molecular weight of 326.53 g/mol, XLogP of 4.09, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-ditert-butyl-N,N'-diethyl-3-methylhexanediamide is sourced from PubChem (CID 166236777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).