C12H25NO2 — CID 58033935
N-tert-butyl-N-ethyl-4-hydroxy-3,3-dimethylbutanamide (PubChem CID 58033935) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is N-tert-butyl-N-ethyl-4-hydroxy-3,3-dimethylbutanamide.
| Compound Name | N-tert-butyl-N-ethyl-4-hydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 58033935 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | N-tert-butyl-N-ethyl-4-hydroxy-3,3-dimethylbutanamide |
| SMILES | CCN(C(=O)CC(C)(C)CO)C(C)(C)C |
| InChI | InChI=1S/C12H25NO2/c1-7-13(11(2,3)4)10(15)8-12(5,6)9-14/h14H,7-9H2,1-6H3 |
| InChIKey | ISCCISCGPYNQID-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |