C12H25NO2 — CID 145483087
ethane;N-ethyl-N-formyl-3,3-dimethylpentanamide (PubChem CID 145483087) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is ethane;N-ethyl-N-formyl-3,3-dimethylpentanamide.
| Compound Name | ethane;N-ethyl-N-formyl-3,3-dimethylpentanamide |
|---|---|
| PubChem CID | 145483087 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | ethane;N-ethyl-N-formyl-3,3-dimethylpentanamide |
| SMILES | CC.CCN(C=O)C(=O)CC(C)(C)CC |
| InChI | InChI=1S/C10H19NO2.C2H6/c1-5-10(3,4)7-9(13)11(6-2)8-12;1-2/h8H,5-7H2,1-4H3;1-2H3 |
| InChIKey | ZIHKYZPXRKAGRB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|