C10H17NO5 — CID 54047371
(2S)-2-[acetyl(ethyl)amino]-2-ethylbutanedioic acid (PubChem CID 54047371) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is (2S)-2-[acetyl(ethyl)amino]-2-ethylbutanedioic acid.
| Compound Name | (2S)-2-[acetyl(ethyl)amino]-2-ethylbutanedioic acid |
|---|---|
| PubChem CID | 54047371 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (2S)-2-[acetyl(ethyl)amino]-2-ethylbutanedioic acid |
| SMILES | CCN(C(C)=O)[C@@](CC)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17NO5/c1-4-10(9(15)16,6-8(13)14)11(5-2)7(3)12/h4-6H2,1-3H3,(H,13,14)(H,15,16)/t10-/m0/s1 |
| InChIKey | LQMSOYAQNYESHX-JTQLQIEISA-N |
| XLogP | 0.56 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |